About triphenyl-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium iodide
triphenyl-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium iodide (PubChem CID 23657252) has the molecular formula C23H22F3INOP
and a molecular weight of 543.31 g/mol. Its IUPAC name is triphenyl-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium iodide.
Molecular Properties
| Compound Name | triphenyl-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium iodide |
| PubChem CID | 23657252 |
| Molecular Formula | C23H22F3INOP |
| Molecular Weight | 543.31 g/mol |
| Exact Mass | 543.04 |
| IUPAC Name | triphenyl-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium iodide |
| SMILES | C[C@@H](C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)C(F)(F)F.[I-] |
| InChI | InChI=1S/C23H21F3NOP.HI/c1-18(27-22(28)23(24,25)26)17-29(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21;/h2-16,18H,17H2,1H3;1H/t18-;/m0./s1 |
| InChIKey | GXIFGGMYCIQMJN-FERBBOLQSA-N |
| XLogP | 1.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 543.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze triphenyl-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenyl-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium iodide?
The IUPAC name of triphenyl-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium iodide (CID 23657252) is triphenyl-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium iodide.
What is the SMILES notation for triphenyl-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium iodide?
The canonical SMILES for triphenyl-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium iodide is C[C@@H](C[P+](c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)C(F)(F)F.[I-].
What is the InChIKey of triphenyl-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium iodide?
The InChIKey is GXIFGGMYCIQMJN-FERBBOLQSA-N. The full InChI is InChI=1S/C23H21F3NOP.HI/c1-18(27-22(28)23(24,25)26)17-29(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21;/h2-16,18H,17H2,1H3;1H/t18-;/m0./s1.
What are the key properties of triphenyl-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium iodide?
triphenyl-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium iodide has a molecular weight of 543.31 g/mol, XLogP of 1.05, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for triphenyl-[(2S)-2-[(2,2,2-trifluoroacetyl)amino]propyl]phosphanium iodide is sourced from PubChem (CID 23657252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).