C24H30F3NO2Si — CID 23657254
N-[(E,2S)-6-[tert-butyl(diphenyl)silyl]oxyhex-3-en-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 23657254) has the molecular formula C24H30F3NO2Si and a molecular weight of 449.59 g/mol. Its IUPAC name is N-[(E,2S)-6-[tert-butyl(diphenyl)silyl]oxyhex-3-en-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(E,2S)-6-[tert-butyl(diphenyl)silyl]oxyhex-3-en-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 23657254 |
| Molecular Formula | C24H30F3NO2Si |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | N-[(E,2S)-6-[tert-butyl(diphenyl)silyl]oxyhex-3-en-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@@H](/C=C/CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C24H30F3NO2Si/c1-19(28-22(29)24(25,26)27)13-11-12-18-30-31(23(2,3)4,20-14-7-5-8-15-20)21-16-9-6-10-17-21/h5-11,13-17,19H,12,18H2,1-4H3,(H,28,29)/b13-11+/t19-/m0/s1 |
| InChIKey | ZYYSKEDOXOKYJL-BPOBUFBUSA-N |
| XLogP | 4.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|