C26H32N2S3 — CID 23657485
4,7-bis(4-hexylthiophen-2-yl)-2,1,3-benzothiadiazole (PubChem CID 23657485) has the molecular formula C26H32N2S3 and a molecular weight of 468.76 g/mol. Its IUPAC name is 4,7-bis(4-hexylthiophen-2-yl)-2,1,3-benzothiadiazole.
| Compound Name | 4,7-bis(4-hexylthiophen-2-yl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 23657485 |
| Molecular Formula | C26H32N2S3 |
| Molecular Weight | 468.76 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 4,7-bis(4-hexylthiophen-2-yl)-2,1,3-benzothiadiazole |
| SMILES | CCCCCCc1csc(-c2ccc(-c3cc(CCCCCC)cs3)c3nsnc23)c1 |
| InChI | InChI=1S/C26H32N2S3/c1-3-5-7-9-11-19-15-23(29-17-19)21-13-14-22(26-25(21)27-31-28-26)24-16-20(18-30-24)12-10-8-6-4-2/h13-18H,3-12H2,1-2H3 |
| InChIKey | XGYRDJVAFZVRTE-UHFFFAOYSA-N |
| XLogP | 9.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.76 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|