C34H49BrClN5O3 — CID 23657682
triethyl-[2-[4-[[6-oxo-6-[2-(1,2,3,4-tetrahydroacridin-9-yl)hydrazinyl]hexyl]carbamoyl]phenoxy]ethyl]azanium;bromide;hydrochloride (PubChem CID 23657682) has the molecular formula C34H49BrClN5O3 and a molecular weight of 691.16 g/mol. Its IUPAC name is triethyl-[2-[4-[[6-oxo-6-[2-(1,2,3,4-tetrahydroacridin-9-yl)hydrazinyl]hexyl]carbamoyl]phenoxy]ethyl]azanium;bromide;hydrochloride.
| Compound Name | triethyl-[2-[4-[[6-oxo-6-[2-(1,2,3,4-tetrahydroacridin-9-yl)hydrazinyl]hexyl]carbamoyl]phenoxy]ethyl]azanium;bromide;hydrochloride |
|---|---|
| PubChem CID | 23657682 |
| Molecular Formula | C34H49BrClN5O3 |
| Molecular Weight | 691.16 g/mol |
| Exact Mass | 689.27 |
| IUPAC Name | triethyl-[2-[4-[[6-oxo-6-[2-(1,2,3,4-tetrahydroacridin-9-yl)hydrazinyl]hexyl]carbamoyl]phenoxy]ethyl]azanium;bromide;hydrochloride |
| SMILES | CC[N+](CC)(CC)CCOc1ccc(C(=O)NCCCCCC(=O)NNc2c3c(nc4ccccc24)CCCC3)cc1.Cl.[Br-] |
| InChI | InChI=1S/C34H47N5O3.BrH.ClH/c1-4-39(5-2,6-3)24-25-42-27-21-19-26(20-22-27)34(41)35-23-13-7-8-18-32(40)37-38-33-28-14-9-11-16-30(28)36-31-17-12-10-15-29(31)33;;/h9,11,14,16,19-22H,4-8,10,12-13,15,17-18,23-25H2,1-3H3,(H2-,35,36,37,38,40,41);2*1H |
| InChIKey | QTEPNTMUOBAANA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.16 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|