C22H21FN4O2S — CID 23658016
(E)-N-[(5-fluoro-3-methyl-1-benzothiophen-2-yl)methyl]-N-methyl-3-(4-oxo-1,2,3,5-tetrahydropyrido[2,3-b][1,4]diazepin-8-yl)prop-2-enamide (PubChem CID 23658016) has the molecular formula C22H21FN4O2S and a molecular weight of 424.50 g/mol. Its IUPAC name is (E)-N-[(5-fluoro-3-methyl-1-benzothiophen-2-yl)methyl]-N-methyl-3-(4-oxo-1,2,3,5-tetrahydropyrido[2,3-b][1,4]diazepin-8-yl)prop-2-enamide.
| Compound Name | (E)-N-[(5-fluoro-3-methyl-1-benzothiophen-2-yl)methyl]-N-methyl-3-(4-oxo-1,2,3,5-tetrahydropyrido[2,3-b][1,4]diazepin-8-yl)prop-2-enamide |
|---|---|
| PubChem CID | 23658016 |
| Molecular Formula | C22H21FN4O2S |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | (E)-N-[(5-fluoro-3-methyl-1-benzothiophen-2-yl)methyl]-N-methyl-3-(4-oxo-1,2,3,5-tetrahydropyrido[2,3-b][1,4]diazepin-8-yl)prop-2-enamide |
| SMILES | Cc1c(CN(C)C(=O)/C=C/c2cnc3c(c2)NCCC(=O)N3)sc2ccc(F)cc12 |
| InChI | InChI=1S/C22H21FN4O2S/c1-13-16-10-15(23)4-5-18(16)30-19(13)12-27(2)21(29)6-3-14-9-17-22(25-11-14)26-20(28)7-8-24-17/h3-6,9-11,24H,7-8,12H2,1-2H3,(H,25,26,28)/b6-3+ |
| InChIKey | SBKBOJWLKBSMKT-ZZXKWVIFSA-N |
| XLogP | 4.17 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|