About 6-[4-amino-4-[(4-tert-butylphenyl)methyl]piperidin-1-yl]-7,9-dihydropurin-8-one
6-[4-amino-4-[(4-tert-butylphenyl)methyl]piperidin-1-yl]-7,9-dihydropurin-8-one (PubChem CID 23658173) has the molecular formula C21H28N6O
and a molecular weight of 380.50 g/mol. Its IUPAC name is 6-[4-amino-4-[(4-tert-butylphenyl)methyl]piperidin-1-yl]-7,9-dihydropurin-8-one.
Molecular Properties
| Compound Name | 6-[4-amino-4-[(4-tert-butylphenyl)methyl]piperidin-1-yl]-7,9-dihydropurin-8-one |
| PubChem CID | 23658173 |
| Molecular Formula | C21H28N6O |
| Molecular Weight | 380.50 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 6-[4-amino-4-[(4-tert-butylphenyl)methyl]piperidin-1-yl]-7,9-dihydropurin-8-one |
| SMILES | CC(C)(C)c1ccc(CC2(N)CCN(c3ncnc4[nH]c(=O)[nH]c34)CC2)cc1 |
| InChI | InChI=1S/C21H28N6O/c1-20(2,3)15-6-4-14(5-7-15)12-21(22)8-10-27(11-9-21)18-16-17(23-13-24-18)26-19(28)25-16/h4-7,13H,8-12,22H2,1-3H3,(H2,23,24,25,26,28) |
| InChIKey | CENSOIHHGQYIKW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[4-amino-4-[(4-tert-butylphenyl)methyl]piperidin-1-yl]-7,9-dihydropurin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-amino-4-[(4-tert-butylphenyl)methyl]piperidin-1-yl]-7,9-dihydropurin-8-one?
The IUPAC name of 6-[4-amino-4-[(4-tert-butylphenyl)methyl]piperidin-1-yl]-7,9-dihydropurin-8-one (CID 23658173) is 6-[4-amino-4-[(4-tert-butylphenyl)methyl]piperidin-1-yl]-7,9-dihydropurin-8-one.
What is the SMILES notation for 6-[4-amino-4-[(4-tert-butylphenyl)methyl]piperidin-1-yl]-7,9-dihydropurin-8-one?
The canonical SMILES for 6-[4-amino-4-[(4-tert-butylphenyl)methyl]piperidin-1-yl]-7,9-dihydropurin-8-one is CC(C)(C)c1ccc(CC2(N)CCN(c3ncnc4[nH]c(=O)[nH]c34)CC2)cc1.
What is the InChIKey of 6-[4-amino-4-[(4-tert-butylphenyl)methyl]piperidin-1-yl]-7,9-dihydropurin-8-one?
The InChIKey is CENSOIHHGQYIKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H28N6O/c1-20(2,3)15-6-4-14(5-7-15)12-21(22)8-10-27(11-9-21)18-16-17(23-13-24-18)26-19(28)25-16/h4-7,13H,8-12,22H2,1-3H3,(H2,23,24,25,26,28).
What are the key properties of 6-[4-amino-4-[(4-tert-butylphenyl)methyl]piperidin-1-yl]-7,9-dihydropurin-8-one?
6-[4-amino-4-[(4-tert-butylphenyl)methyl]piperidin-1-yl]-7,9-dihydropurin-8-one has a molecular weight of 380.50 g/mol, XLogP of 2.48, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-amino-4-[(4-tert-butylphenyl)methyl]piperidin-1-yl]-7,9-dihydropurin-8-one is sourced from PubChem (CID 23658173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).