C28H24FNO3 — CID 23658429
(3R,4S)-3-(3-azulen-2-yloxypropyl)-1-(4-fluorophenyl)-4-(4-hydroxyphenyl)azetidin-2-one (PubChem CID 23658429) has the molecular formula C28H24FNO3 and a molecular weight of 441.50 g/mol. Its IUPAC name is (3R,4S)-3-(3-azulen-2-yloxypropyl)-1-(4-fluorophenyl)-4-(4-hydroxyphenyl)azetidin-2-one.
| Compound Name | (3R,4S)-3-(3-azulen-2-yloxypropyl)-1-(4-fluorophenyl)-4-(4-hydroxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 23658429 |
| Molecular Formula | C28H24FNO3 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | (3R,4S)-3-(3-azulen-2-yloxypropyl)-1-(4-fluorophenyl)-4-(4-hydroxyphenyl)azetidin-2-one |
| SMILES | O=C1[C@H](CCCOc2cc3cccccc-3c2)[C@@H](c2ccc(O)cc2)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C28H24FNO3/c29-22-10-12-23(13-11-22)30-27(19-8-14-24(31)15-9-19)26(28(30)32)7-4-16-33-25-17-20-5-2-1-3-6-21(20)18-25/h1-3,5-6,8-15,17-18,26-27,31H,4,7,16H2/t26-,27-/m1/s1 |
| InChIKey | QTHFVBANGFTWAC-KAYWLYCHSA-N |
| XLogP | 6.20 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|