C30H20N2O4S3 — CID 23658761
4,21-bis(benzenesulfonyl)-2-thia-4,21-diazapentacyclo[12.7.0.03,11.05,10.015,20]henicosa-1(14),3(11),5,7,9,12,15,17,19-nonaene (PubChem CID 23658761) has the molecular formula C30H20N2O4S3 and a molecular weight of 568.70 g/mol. Its IUPAC name is 4,21-bis(benzenesulfonyl)-2-thia-4,21-diazapentacyclo[12.7.0.03,11.05,10.015,20]henicosa-1(14),3(11),5,7,9,12,15,17,19-nonaene.
| Compound Name | 4,21-bis(benzenesulfonyl)-2-thia-4,21-diazapentacyclo[12.7.0.03,11.05,10.015,20]henicosa-1(14),3(11),5,7,9,12,15,17,19-nonaene |
|---|---|
| PubChem CID | 23658761 |
| Molecular Formula | C30H20N2O4S3 |
| Molecular Weight | 568.70 g/mol |
| Exact Mass | 568.06 |
| IUPAC Name | 4,21-bis(benzenesulfonyl)-2-thia-4,21-diazapentacyclo[12.7.0.03,11.05,10.015,20]henicosa-1(14),3(11),5,7,9,12,15,17,19-nonaene |
| SMILES | O=S(=O)(c1ccccc1)n1c2c(c3ccccc31)C=Cc1c(n(S(=O)(=O)c3ccccc3)c3ccccc13)S2 |
| InChI | InChI=1S/C30H20N2O4S3/c33-38(34,21-11-3-1-4-12-21)31-27-17-9-7-15-23(27)25-19-20-26-24-16-8-10-18-28(24)32(30(26)37-29(25)31)39(35,36)22-13-5-2-6-14-22/h1-20H |
| InChIKey | MRIZAXIWDZWXNM-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.70 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |