C22H18N4OS — CID 23658922
N-phenyl-7-(phenylcarbamothioylamino)-1H-indole-2-carboxamide (PubChem CID 23658922) has the molecular formula C22H18N4OS and a molecular weight of 386.48 g/mol. Its IUPAC name is N-phenyl-7-(phenylcarbamothioylamino)-1H-indole-2-carboxamide.
| Compound Name | N-phenyl-7-(phenylcarbamothioylamino)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 23658922 |
| Molecular Formula | C22H18N4OS |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | N-phenyl-7-(phenylcarbamothioylamino)-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cc2cccc(NC(=S)Nc3ccccc3)c2[nH]1 |
| InChI | InChI=1S/C22H18N4OS/c27-21(23-16-9-3-1-4-10-16)19-14-15-8-7-13-18(20(15)25-19)26-22(28)24-17-11-5-2-6-12-17/h1-14,25H,(H,23,27)(H2,24,26,28) |
| InChIKey | XUWYNVRNACBHNE-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 68.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|