About metoclopramide hydrochloride anhydrous
metoclopramide hydrochloride anhydrous (PubChem CID 23659) has the molecular formula C14H23Cl2N3O2
and a molecular weight of 336.30 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide;hydrochloride.
Molecular Properties
| Compound Name | metoclopramide hydrochloride anhydrous |
| PubChem CID | 23659 |
| Molecular Formula | C14H23Cl2N3O2 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide;hydrochloride |
| SMILES | CCN(CC)CCNC(=O)C1=CC(=C(C=C1OC)N)Cl.Cl |
| InChI | InChI=1S/C14H22ClN3O2.ClH/c1-4-18(5-2)7-6-17-14(19)10-8-11(15)12(16)9-13(10)20-3;/h8-9H,4-7,16H2,1-3H3,(H,17,19);1H |
| InChIKey | RVFUNJWWXKCWNS-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 67.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | 300 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze metoclopramide hydrochloride anhydrous with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of metoclopramide hydrochloride anhydrous?
The IUPAC name of metoclopramide hydrochloride anhydrous (CID 23659) is 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide;hydrochloride.
What is the SMILES notation for metoclopramide hydrochloride anhydrous?
The canonical SMILES for metoclopramide hydrochloride anhydrous is CCN(CC)CCNC(=O)C1=CC(=C(C=C1OC)N)Cl.Cl.
What is the InChIKey of metoclopramide hydrochloride anhydrous?
The InChIKey is RVFUNJWWXKCWNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22ClN3O2.ClH/c1-4-18(5-2)7-6-17-14(19)10-8-11(15)12(16)9-13(10)20-3;/h8-9H,4-7,16H2,1-3H3,(H,17,19);1H.
What are the key properties of metoclopramide hydrochloride anhydrous?
metoclopramide hydrochloride anhydrous has a molecular weight of 336.30 g/mol, XLogP of not available, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for metoclopramide hydrochloride anhydrous is sourced from PubChem (CID 23659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).