C21H24FNO6S — CID 23659122
diethyl 2-[(4-fluorophenyl)-[(4-methylphenyl)sulfonylamino]methyl]propanedioate (PubChem CID 23659122) has the molecular formula C21H24FNO6S and a molecular weight of 437.49 g/mol. Its IUPAC name is diethyl 2-[(4-fluorophenyl)-[(4-methylphenyl)sulfonylamino]methyl]propanedioate.
| Compound Name | diethyl 2-[(4-fluorophenyl)-[(4-methylphenyl)sulfonylamino]methyl]propanedioate |
|---|---|
| PubChem CID | 23659122 |
| Molecular Formula | C21H24FNO6S |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | diethyl 2-[(4-fluorophenyl)-[(4-methylphenyl)sulfonylamino]methyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(NS(=O)(=O)c1ccc(C)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H24FNO6S/c1-4-28-20(24)18(21(25)29-5-2)19(15-8-10-16(22)11-9-15)23-30(26,27)17-12-6-14(3)7-13-17/h6-13,18-19,23H,4-5H2,1-3H3 |
| InChIKey | GIIUDNJNEBFXMC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|