C21H27NO6 — CID 23659168
bis(prop-2-enyl) 2-[(S)-[(2-methylpropan-2-yl)oxycarbonylamino]-phenylmethyl]propanedioate (PubChem CID 23659168) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is bis(prop-2-enyl) 2-[(S)-[(2-methylpropan-2-yl)oxycarbonylamino]-phenylmethyl]propanedioate.
| Compound Name | bis(prop-2-enyl) 2-[(S)-[(2-methylpropan-2-yl)oxycarbonylamino]-phenylmethyl]propanedioate |
|---|---|
| PubChem CID | 23659168 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | bis(prop-2-enyl) 2-[(S)-[(2-methylpropan-2-yl)oxycarbonylamino]-phenylmethyl]propanedioate |
| SMILES | C=CCOC(=O)C(C(=O)OCC=C)[C@H](NC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H27NO6/c1-6-13-26-18(23)16(19(24)27-14-7-2)17(15-11-9-8-10-12-15)22-20(25)28-21(3,4)5/h6-12,16-17H,1-2,13-14H2,3-5H3,(H,22,25)/t17-/m1/s1 |
| InChIKey | XKIZUDSIUVTQIZ-QGZVFWFLSA-N |
| XLogP | 3.33 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|