About 3-[(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazine-2-carbonitrile
3-[(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazine-2-carbonitrile (PubChem CID 23659325) has the molecular formula C12H13N5S3
and a molecular weight of 323.47 g/mol. Its IUPAC name is 3-[(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-[(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazine-2-carbonitrile |
| PubChem CID | 23659325 |
| Molecular Formula | C12H13N5S3 |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 3-[(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazine-2-carbonitrile |
| SMILES | CCCCCSc1nnc(Sc2nccnc2C#N)s1 |
| InChI | InChI=1S/C12H13N5S3/c1-2-3-4-7-18-11-16-17-12(20-11)19-10-9(8-13)14-5-6-15-10/h5-6H,2-4,7H2,1H3 |
| InChIKey | NHWCAZGNPPFLDP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazine-2-carbonitrile?
The IUPAC name of 3-[(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazine-2-carbonitrile (CID 23659325) is 3-[(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazine-2-carbonitrile.
What is the SMILES notation for 3-[(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazine-2-carbonitrile?
The canonical SMILES for 3-[(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazine-2-carbonitrile is CCCCCSc1nnc(Sc2nccnc2C#N)s1.
What is the InChIKey of 3-[(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazine-2-carbonitrile?
The InChIKey is NHWCAZGNPPFLDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N5S3/c1-2-3-4-7-18-11-16-17-12(20-11)19-10-9(8-13)14-5-6-15-10/h5-6H,2-4,7H2,1H3.
What are the key properties of 3-[(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazine-2-carbonitrile?
3-[(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazine-2-carbonitrile has a molecular weight of 323.47 g/mol, XLogP of 3.63, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-pentylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]pyrazine-2-carbonitrile is sourced from PubChem (CID 23659325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).