About 3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]pyrazine-2-carbonitrile
3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]pyrazine-2-carbonitrile (PubChem CID 23659328) has the molecular formula C7H3N5S3
and a molecular weight of 253.34 g/mol. Its IUPAC name is 3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]pyrazine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]pyrazine-2-carbonitrile |
| PubChem CID | 23659328 |
| Molecular Formula | C7H3N5S3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 252.96 |
| IUPAC Name | 3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1Sc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C7H3N5S3/c8-3-4-5(10-2-1-9-4)14-7-12-11-6(13)15-7/h1-2H,(H,11,13) |
| InChIKey | UNJLGBSXWFPNOL-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]pyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]pyrazine-2-carbonitrile?
The IUPAC name of 3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]pyrazine-2-carbonitrile (CID 23659328) is 3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]pyrazine-2-carbonitrile.
What is the SMILES notation for 3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]pyrazine-2-carbonitrile?
The canonical SMILES for 3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]pyrazine-2-carbonitrile is N#Cc1nccnc1Sc1n[nH]c(=S)s1.
What is the InChIKey of 3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]pyrazine-2-carbonitrile?
The InChIKey is UNJLGBSXWFPNOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3N5S3/c8-3-4-5(10-2-1-9-4)14-7-12-11-6(13)15-7/h1-2H,(H,11,13).
What are the key properties of 3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]pyrazine-2-carbonitrile?
3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]pyrazine-2-carbonitrile has a molecular weight of 253.34 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)sulfanyl]pyrazine-2-carbonitrile is sourced from PubChem (CID 23659328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).