C15H20O8 — CID 23659479
3-O-ethyl 5-O,5-O'-dimethyl (3S,3aR,7aR)-2-oxo-3,3a,4,6,7,7a-hexahydro-1-benzofuran-3,5,5-tricarboxylate (PubChem CID 23659479) has the molecular formula C15H20O8 and a molecular weight of 328.32 g/mol. Its IUPAC name is 3-O-ethyl 5-O,5-O'-dimethyl (3S,3aR,7aR)-2-oxo-3,3a,4,6,7,7a-hexahydro-1-benzofuran-3,5,5-tricarboxylate.
| Compound Name | 3-O-ethyl 5-O,5-O'-dimethyl (3S,3aR,7aR)-2-oxo-3,3a,4,6,7,7a-hexahydro-1-benzofuran-3,5,5-tricarboxylate |
|---|---|
| PubChem CID | 23659479 |
| Molecular Formula | C15H20O8 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 3-O-ethyl 5-O,5-O'-dimethyl (3S,3aR,7aR)-2-oxo-3,3a,4,6,7,7a-hexahydro-1-benzofuran-3,5,5-tricarboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)O[C@@H]2CCC(C(=O)OC)(C(=O)OC)C[C@H]12 |
| InChI | InChI=1S/C15H20O8/c1-4-22-11(16)10-8-7-15(13(18)20-2,14(19)21-3)6-5-9(8)23-12(10)17/h8-10H,4-7H2,1-3H3/t8-,9+,10-/m0/s1 |
| InChIKey | GHFJGMPBWSSZOH-AEJSXWLSSA-N |
| XLogP | 0.22 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|