C17H24O6 — CID 23659480
diethyl (3S,3aR,5aR,9aS)-2-oxo-3,3a,4,5,6,7,8,9-octahydroindeno[7a,1-b]furan-3,5a-dicarboxylate (PubChem CID 23659480) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is diethyl (3S,3aR,5aR,9aS)-2-oxo-3,3a,4,5,6,7,8,9-octahydroindeno[7a,1-b]furan-3,5a-dicarboxylate.
| Compound Name | diethyl (3S,3aR,5aR,9aS)-2-oxo-3,3a,4,5,6,7,8,9-octahydroindeno[7a,1-b]furan-3,5a-dicarboxylate |
|---|---|
| PubChem CID | 23659480 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | diethyl (3S,3aR,5aR,9aS)-2-oxo-3,3a,4,5,6,7,8,9-octahydroindeno[7a,1-b]furan-3,5a-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)O[C@]23CCCC[C@@]2(C(=O)OCC)CC[C@H]13 |
| InChI | InChI=1S/C17H24O6/c1-3-21-13(18)12-11-7-10-16(15(20)22-4-2)8-5-6-9-17(11,16)23-14(12)19/h11-12H,3-10H2,1-2H3/t11-,12+,16+,17+/m1/s1 |
| InChIKey | CIQRMBZPQNFPGI-YIFBXAAPSA-N |
| XLogP | 1.99 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|