About 3-[(5-methylsulfanyl-1,2,4-thiadiazol-3-yl)sulfanyl]pyrazine-2-carbonitrile
3-[(5-methylsulfanyl-1,2,4-thiadiazol-3-yl)sulfanyl]pyrazine-2-carbonitrile (PubChem CID 23659518) has the molecular formula C8H5N5S3
and a molecular weight of 267.36 g/mol. Its IUPAC name is 3-[(5-methylsulfanyl-1,2,4-thiadiazol-3-yl)sulfanyl]pyrazine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-[(5-methylsulfanyl-1,2,4-thiadiazol-3-yl)sulfanyl]pyrazine-2-carbonitrile |
| PubChem CID | 23659518 |
| Molecular Formula | C8H5N5S3 |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 266.97 |
| IUPAC Name | 3-[(5-methylsulfanyl-1,2,4-thiadiazol-3-yl)sulfanyl]pyrazine-2-carbonitrile |
| SMILES | CSc1nc(Sc2nccnc2C#N)ns1 |
| InChI | InChI=1S/C8H5N5S3/c1-14-8-12-7(13-16-8)15-6-5(4-9)10-2-3-11-6/h2-3H,1H3 |
| InChIKey | LYABNWNXXFWXNF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 75.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-[(5-methylsulfanyl-1,2,4-thiadiazol-3-yl)sulfanyl]pyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-methylsulfanyl-1,2,4-thiadiazol-3-yl)sulfanyl]pyrazine-2-carbonitrile?
The IUPAC name of 3-[(5-methylsulfanyl-1,2,4-thiadiazol-3-yl)sulfanyl]pyrazine-2-carbonitrile (CID 23659518) is 3-[(5-methylsulfanyl-1,2,4-thiadiazol-3-yl)sulfanyl]pyrazine-2-carbonitrile.
What is the SMILES notation for 3-[(5-methylsulfanyl-1,2,4-thiadiazol-3-yl)sulfanyl]pyrazine-2-carbonitrile?
The canonical SMILES for 3-[(5-methylsulfanyl-1,2,4-thiadiazol-3-yl)sulfanyl]pyrazine-2-carbonitrile is CSc1nc(Sc2nccnc2C#N)ns1.
What is the InChIKey of 3-[(5-methylsulfanyl-1,2,4-thiadiazol-3-yl)sulfanyl]pyrazine-2-carbonitrile?
The InChIKey is LYABNWNXXFWXNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N5S3/c1-14-8-12-7(13-16-8)15-6-5(4-9)10-2-3-11-6/h2-3H,1H3.
What are the key properties of 3-[(5-methylsulfanyl-1,2,4-thiadiazol-3-yl)sulfanyl]pyrazine-2-carbonitrile?
3-[(5-methylsulfanyl-1,2,4-thiadiazol-3-yl)sulfanyl]pyrazine-2-carbonitrile has a molecular weight of 267.36 g/mol, XLogP of 2.07, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-methylsulfanyl-1,2,4-thiadiazol-3-yl)sulfanyl]pyrazine-2-carbonitrile is sourced from PubChem (CID 23659518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).