C15H25NO6 — CID 23660151
tert-butyl N-[(2R,3R,4R,5S)-3,5-dihydroxy-2-(4-hydroxybut-2-ynyl)oxan-4-yl]-N-methylcarbamate (PubChem CID 23660151) has the molecular formula C15H25NO6 and a molecular weight of 315.37 g/mol. Its IUPAC name is tert-butyl N-[(2R,3R,4R,5S)-3,5-dihydroxy-2-(4-hydroxybut-2-ynyl)oxan-4-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(2R,3R,4R,5S)-3,5-dihydroxy-2-(4-hydroxybut-2-ynyl)oxan-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 23660151 |
| Molecular Formula | C15H25NO6 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | tert-butyl N-[(2R,3R,4R,5S)-3,5-dihydroxy-2-(4-hydroxybut-2-ynyl)oxan-4-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)[C@H]1[C@@H](O)[C@@H](CC#CCO)OC[C@H]1O |
| InChI | InChI=1S/C15H25NO6/c1-15(2,3)22-14(20)16(4)12-10(18)9-21-11(13(12)19)7-5-6-8-17/h10-13,17-19H,7-9H2,1-4H3/t10-,11-,12-,13+/m1/s1 |
| InChIKey | WDTFXDSDDZOALK-LPWJVIDDSA-N |
| XLogP | -0.27 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|