C19H24O7 — CID 23660295
benzyl (1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboxylate (PubChem CID 23660295) has the molecular formula C19H24O7 and a molecular weight of 364.39 g/mol. Its IUPAC name is benzyl (1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboxylate.
| Compound Name | benzyl (1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboxylate |
|---|---|
| PubChem CID | 23660295 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | benzyl (1R,2S,6R,8S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-6-carboxylate |
| SMILES | CC1(C)OC[C@@H]2O[C@@]3(C(=O)OCc4ccccc4)OC(C)(C)O[C@H]3[C@@H]2O1 |
| InChI | InChI=1S/C19H24O7/c1-17(2)22-11-13-14(24-17)15-19(23-13,26-18(3,4)25-15)16(20)21-10-12-8-6-5-7-9-12/h5-9,13-15H,10-11H2,1-4H3/t13-,14+,15-,19+/m0/s1 |
| InChIKey | PNCULYCATUKVNY-QCUYGVNKSA-N |
| XLogP | 2.13 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |