C40H44O2S4 — CID 23660361
3,9,17,23-tetratert-butyl-13,27-dioxa-6,20,29,30-tetrathiaheptacyclo[23.3.1.111,15.05,28.07,12.014,19.021,26]triaconta-1,3,5(28),7(12),8,10,14(19),15,17,21(26),22,24-dodecaene (PubChem CID 23660361) has the molecular formula C40H44O2S4 and a molecular weight of 685.06 g/mol. Its IUPAC name is 3,9,17,23-tetratert-butyl-13,27-dioxa-6,20,29,30-tetrathiaheptacyclo[23.3.1.111,15.05,28.07,12.014,19.021,26]triaconta-1,3,5(28),7(12),8,10,14(19),15,17,21(26),22,24-dodecaene.
| Compound Name | 3,9,17,23-tetratert-butyl-13,27-dioxa-6,20,29,30-tetrathiaheptacyclo[23.3.1.111,15.05,28.07,12.014,19.021,26]triaconta-1,3,5(28),7(12),8,10,14(19),15,17,21(26),22,24-dodecaene |
|---|---|
| PubChem CID | 23660361 |
| Molecular Formula | C40H44O2S4 |
| Molecular Weight | 685.06 g/mol |
| Exact Mass | 684.22 |
| IUPAC Name | 3,9,17,23-tetratert-butyl-13,27-dioxa-6,20,29,30-tetrathiaheptacyclo[23.3.1.111,15.05,28.07,12.014,19.021,26]triaconta-1,3,5(28),7(12),8,10,14(19),15,17,21(26),22,24-dodecaene |
| SMILES | CC(C)(C)c1cc2sc3cc(C(C)(C)C)cc4sc5cc(C(C)(C)C)cc6sc7cc(C(C)(C)C)cc(sc(c1)c2oc34)c7oc65 |
| InChI | InChI=1S/C40H44O2S4/c1-37(2,3)21-13-25-33-29(17-21)45-30-18-23(39(7,8)9)15-27-35(30)42-36-28(44-27)16-24(40(10,11)12)20-32(36)46-31-19-22(38(4,5)6)14-26(43-25)34(31)41-33/h13-20H,1-12H3 |
| InChIKey | MDOOWFWZUXENHQ-UHFFFAOYSA-N |
| XLogP | 14.91 |
| TPSA | 26.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.06 |
| LogP ≤ 5 | 14.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|