C24H33NO6S — CID 23660571
[(2S)-2-(furan-2-yl)-2-[(2R)-4-oxoazetidin-2-yl]oxyethyl] 2,4,6-tri(propan-2-yl)benzenesulfonate (PubChem CID 23660571) has the molecular formula C24H33NO6S and a molecular weight of 463.60 g/mol. Its IUPAC name is [(2S)-2-(furan-2-yl)-2-[(2R)-4-oxoazetidin-2-yl]oxyethyl] 2,4,6-tri(propan-2-yl)benzenesulfonate.
| Compound Name | [(2S)-2-(furan-2-yl)-2-[(2R)-4-oxoazetidin-2-yl]oxyethyl] 2,4,6-tri(propan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 23660571 |
| Molecular Formula | C24H33NO6S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | [(2S)-2-(furan-2-yl)-2-[(2R)-4-oxoazetidin-2-yl]oxyethyl] 2,4,6-tri(propan-2-yl)benzenesulfonate |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)OC[C@H](O[C@@H]2CC(=O)N2)c2ccco2)c(C(C)C)c1 |
| InChI | InChI=1S/C24H33NO6S/c1-14(2)17-10-18(15(3)4)24(19(11-17)16(5)6)32(27,28)30-13-21(20-8-7-9-29-20)31-23-12-22(26)25-23/h7-11,14-16,21,23H,12-13H2,1-6H3,(H,25,26)/t21-,23+/m0/s1 |
| InChIKey | NECFNLWPWMITOP-JTHBVZDNSA-N |
| XLogP | 4.96 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|