About CID 23660617
CID 23660617 (PubChem CID 23660617) has the molecular formula C21H17ClNO2
and a molecular weight of 350.83 g/mol.
Molecular Properties
| Compound Name | CID 23660617 |
| PubChem CID | 23660617 |
| Molecular Formula | C21H17ClNO2 |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | — |
| SMILES | [O]N1c2ccccc2OCC1(Cc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H17ClNO2/c22-18-12-10-17(11-13-18)21(14-16-6-2-1-3-7-16)15-25-20-9-5-4-8-19(20)23(21)24/h1-13H,14-15H2 |
| InChIKey | QKTCASHYLTZHML-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 32.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 23660617 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23660617?
The IUPAC name of CID 23660617 (CID 23660617) is not available.
What is the SMILES notation for CID 23660617?
The canonical SMILES for CID 23660617 is [O]N1c2ccccc2OCC1(Cc1ccccc1)c1ccc(Cl)cc1.
What is the InChIKey of CID 23660617?
The InChIKey is QKTCASHYLTZHML-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17ClNO2/c22-18-12-10-17(11-13-18)21(14-16-6-2-1-3-7-16)15-25-20-9-5-4-8-19(20)23(21)24/h1-13H,14-15H2.
What are the key properties of CID 23660617?
CID 23660617 has a molecular weight of 350.83 g/mol, XLogP of 5.02, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23660617 is sourced from PubChem (CID 23660617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).