C21H17ClNO2 — CID 23660617
CID 23660617 (PubChem CID 23660617) has the molecular formula C21H17ClNO2 and a molecular weight of 350.83 g/mol.
| Compound Name | CID 23660617 |
|---|---|
| PubChem CID | 23660617 |
| Molecular Formula | C21H17ClNO2 |
| Molecular Weight | 350.83 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | — |
| SMILES | [O]N1c2ccccc2OCC1(Cc1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H17ClNO2/c22-18-12-10-17(11-13-18)21(14-16-6-2-1-3-7-16)15-25-20-9-5-4-8-19(20)23(21)24/h1-13H,14-15H2 |
| InChIKey | QKTCASHYLTZHML-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 32.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.83 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |