C24H30N2OS — CID 23661522
(3S,5R)-3-benzyl-5-but-3-enyl-1-(2-phenylsulfanylethyl)-1,4-diazepan-2-one (PubChem CID 23661522) has the molecular formula C24H30N2OS and a molecular weight of 394.58 g/mol. Its IUPAC name is (3S,5R)-3-benzyl-5-but-3-enyl-1-(2-phenylsulfanylethyl)-1,4-diazepan-2-one.
| Compound Name | (3S,5R)-3-benzyl-5-but-3-enyl-1-(2-phenylsulfanylethyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 23661522 |
| Molecular Formula | C24H30N2OS |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (3S,5R)-3-benzyl-5-but-3-enyl-1-(2-phenylsulfanylethyl)-1,4-diazepan-2-one |
| SMILES | C=CCC[C@@H]1CCN(CCSc2ccccc2)C(=O)[C@H](Cc2ccccc2)N1 |
| InChI | InChI=1S/C24H30N2OS/c1-2-3-12-21-15-16-26(17-18-28-22-13-8-5-9-14-22)24(27)23(25-21)19-20-10-6-4-7-11-20/h2,4-11,13-14,21,23,25H,1,3,12,15-19H2/t21-,23+/m1/s1 |
| InChIKey | CKTUVIYWYPYKHD-GGAORHGYSA-N |
| XLogP | 4.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|