About [(2R,3S,5R)-5-(6-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl benzoate
[(2R,3S,5R)-5-(6-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl benzoate (PubChem CID 23661673) has the molecular formula C17H15ClN4O4
and a molecular weight of 374.78 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl benzoate.
Molecular Properties
| Compound Name | [(2R,3S,5R)-5-(6-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl benzoate |
| PubChem CID | 23661673 |
| Molecular Formula | C17H15ClN4O4 |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | [(2R,3S,5R)-5-(6-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](n2cnc3c(Cl)ncnc32)C[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C17H15ClN4O4/c18-15-14-16(20-8-19-15)22(9-21-14)13-6-11(23)12(26-13)7-25-17(24)10-4-2-1-3-5-10/h1-5,8-9,11-13,23H,6-7H2/t11-,12+,13+/m0/s1 |
| InChIKey | AIBVFFNTCLUCRL-YNEHKIRRSA-N |
| XLogP | 1.99 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [(2R,3S,5R)-5-(6-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S,5R)-5-(6-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl benzoate?
The IUPAC name of [(2R,3S,5R)-5-(6-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl benzoate (CID 23661673) is [(2R,3S,5R)-5-(6-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl benzoate.
What is the SMILES notation for [(2R,3S,5R)-5-(6-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl benzoate?
The canonical SMILES for [(2R,3S,5R)-5-(6-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl benzoate is O=C(OC[C@H]1O[C@@H](n2cnc3c(Cl)ncnc32)C[C@@H]1O)c1ccccc1.
What is the InChIKey of [(2R,3S,5R)-5-(6-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl benzoate?
The InChIKey is AIBVFFNTCLUCRL-YNEHKIRRSA-N. The full InChI is InChI=1S/C17H15ClN4O4/c18-15-14-16(20-8-19-15)22(9-21-14)13-6-11(23)12(26-13)7-25-17(24)10-4-2-1-3-5-10/h1-5,8-9,11-13,23H,6-7H2/t11-,12+,13+/m0/s1.
What are the key properties of [(2R,3S,5R)-5-(6-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl benzoate?
[(2R,3S,5R)-5-(6-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl benzoate has a molecular weight of 374.78 g/mol, XLogP of 1.99, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S,5R)-5-(6-chloropurin-9-yl)-3-hydroxyoxolan-2-yl]methyl benzoate is sourced from PubChem (CID 23661673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).