C10H8BrN5OS2 — CID 23661710
1-[(E)-(4-bromophenyl)methylideneamino]-3-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)urea (PubChem CID 23661710) has the molecular formula C10H8BrN5OS2 and a molecular weight of 358.25 g/mol. Its IUPAC name is 1-[(E)-(4-bromophenyl)methylideneamino]-3-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)urea.
| Compound Name | 1-[(E)-(4-bromophenyl)methylideneamino]-3-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)urea |
|---|---|
| PubChem CID | 23661710 |
| Molecular Formula | C10H8BrN5OS2 |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 356.94 |
| IUPAC Name | 1-[(E)-(4-bromophenyl)methylideneamino]-3-(2-sulfanylidene-3H-1,3,4-thiadiazol-5-yl)urea |
| SMILES | O=C(N/N=C/c1ccc(Br)cc1)Nc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C10H8BrN5OS2/c11-7-3-1-6(2-4-7)5-12-14-8(17)13-9-15-16-10(18)19-9/h1-5H,(H,16,18)(H2,13,14,15,17)/b12-5+ |
| InChIKey | IFEPNUWGMXQWOG-LFYBBSHMSA-N |
| XLogP | 3.12 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|