C19H18F6N6O2 — CID 23661718
(3R,4R)-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-4-(2,4,5-trifluorophenyl)piperidin-3-amine;2,2,2-trifluoroacetic acid (PubChem CID 23661718) has the molecular formula C19H18F6N6O2 and a molecular weight of 476.38 g/mol. Its IUPAC name is (3R,4R)-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-4-(2,4,5-trifluorophenyl)piperidin-3-amine;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,4R)-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-4-(2,4,5-trifluorophenyl)piperidin-3-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23661718 |
| Molecular Formula | C19H18F6N6O2 |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | (3R,4R)-1-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-4-(2,4,5-trifluorophenyl)piperidin-3-amine;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nnc2ccc(N3CC[C@H](c4cc(F)c(F)cc4F)[C@@H](N)C3)nn12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H17F3N6.C2HF3O2/c1-9-22-23-16-2-3-17(24-26(9)16)25-5-4-10(15(21)8-25)11-6-13(19)14(20)7-12(11)18;3-2(4,5)1(6)7/h2-3,6-7,10,15H,4-5,8,21H2,1H3;(H,6,7)/t10-,15+;/m1./s1 |
| InChIKey | ITPLNQPRWKTJNI-VSLILLSYSA-N |
| XLogP | 2.80 |
| TPSA | 109.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|