About N-[(E)-1-(6-methyl-2,4-dioxopyran-3-yl)ethylideneamino]pyridine-4-carboxamide
N-[(E)-1-(6-methyl-2,4-dioxopyran-3-yl)ethylideneamino]pyridine-4-carboxamide (PubChem CID 23661790) has the molecular formula C14H13N3O4
and a molecular weight of 287.27 g/mol. Its IUPAC name is N-[(E)-1-(6-methyl-2,4-dioxopyran-3-yl)ethylideneamino]pyridine-4-carboxamide.
Molecular Properties
| Compound Name | N-[(E)-1-(6-methyl-2,4-dioxopyran-3-yl)ethylideneamino]pyridine-4-carboxamide |
| PubChem CID | 23661790 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N-[(E)-1-(6-methyl-2,4-dioxopyran-3-yl)ethylideneamino]pyridine-4-carboxamide |
| SMILES | CC1=CC(=O)C(/C(C)=N/NC(=O)c2ccncc2)C(=O)O1 |
| InChI | InChI=1S/C14H13N3O4/c1-8-7-11(18)12(14(20)21-8)9(2)16-17-13(19)10-3-5-15-6-4-10/h3-7,12H,1-2H3,(H,17,19)/b16-9+ |
| InChIKey | LNVBSFRRBYMQJJ-CXUHLZMHSA-N |
| XLogP | 0.83 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-1-(6-methyl-2,4-dioxopyran-3-yl)ethylideneamino]pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-1-(6-methyl-2,4-dioxopyran-3-yl)ethylideneamino]pyridine-4-carboxamide?
The IUPAC name of N-[(E)-1-(6-methyl-2,4-dioxopyran-3-yl)ethylideneamino]pyridine-4-carboxamide (CID 23661790) is N-[(E)-1-(6-methyl-2,4-dioxopyran-3-yl)ethylideneamino]pyridine-4-carboxamide.
What is the SMILES notation for N-[(E)-1-(6-methyl-2,4-dioxopyran-3-yl)ethylideneamino]pyridine-4-carboxamide?
The canonical SMILES for N-[(E)-1-(6-methyl-2,4-dioxopyran-3-yl)ethylideneamino]pyridine-4-carboxamide is CC1=CC(=O)C(/C(C)=N/NC(=O)c2ccncc2)C(=O)O1.
What is the InChIKey of N-[(E)-1-(6-methyl-2,4-dioxopyran-3-yl)ethylideneamino]pyridine-4-carboxamide?
The InChIKey is LNVBSFRRBYMQJJ-CXUHLZMHSA-N. The full InChI is InChI=1S/C14H13N3O4/c1-8-7-11(18)12(14(20)21-8)9(2)16-17-13(19)10-3-5-15-6-4-10/h3-7,12H,1-2H3,(H,17,19)/b16-9+.
What are the key properties of N-[(E)-1-(6-methyl-2,4-dioxopyran-3-yl)ethylideneamino]pyridine-4-carboxamide?
N-[(E)-1-(6-methyl-2,4-dioxopyran-3-yl)ethylideneamino]pyridine-4-carboxamide has a molecular weight of 287.27 g/mol, XLogP of 0.83, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-1-(6-methyl-2,4-dioxopyran-3-yl)ethylideneamino]pyridine-4-carboxamide is sourced from PubChem (CID 23661790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).