About sodium 2-methylpropanedithioate
sodium 2-methylpropanedithioate (PubChem CID 23662182) has the molecular formula C4H7NaS2
and a molecular weight of 142.22 g/mol. Its IUPAC name is sodium 2-methylpropanedithioate.
Molecular Properties
| Compound Name | sodium 2-methylpropanedithioate |
| PubChem CID | 23662182 |
| Molecular Formula | C4H7NaS2 |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 141.99 |
| IUPAC Name | sodium 2-methylpropanedithioate |
| SMILES | CC(C)C(=S)[S-].[Na+] |
| InChI | InChI=1S/C4H8S2.Na/c1-3(2)4(5)6;/h3H,1-2H3,(H,5,6);/q;+1/p-1 |
| InChIKey | PXJMGSPUAAIINE-UHFFFAOYSA-M |
| XLogP | -1.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-methylpropanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-methylpropanedithioate?
The IUPAC name of sodium 2-methylpropanedithioate (CID 23662182) is sodium 2-methylpropanedithioate.
What is the SMILES notation for sodium 2-methylpropanedithioate?
The canonical SMILES for sodium 2-methylpropanedithioate is CC(C)C(=S)[S-].[Na+].
What is the InChIKey of sodium 2-methylpropanedithioate?
The InChIKey is PXJMGSPUAAIINE-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H8S2.Na/c1-3(2)4(5)6;/h3H,1-2H3,(H,5,6);/q;+1/p-1.
What are the key properties of sodium 2-methylpropanedithioate?
sodium 2-methylpropanedithioate has a molecular weight of 142.22 g/mol, XLogP of -1.48, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-methylpropanedithioate is sourced from PubChem (CID 23662182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).