About sodium 1H-pyrazolo[5,4-d]pyrimidin-4-olate
sodium 1H-pyrazolo[5,4-d]pyrimidin-4-olate (PubChem CID 23662349) has the molecular formula C5H3N4NaO
and a molecular weight of 158.10 g/mol. Its IUPAC name is sodium 1H-pyrazolo[5,4-d]pyrimidin-4-olate.
Molecular Properties
| Compound Name | sodium 1H-pyrazolo[5,4-d]pyrimidin-4-olate |
| PubChem CID | 23662349 |
| Molecular Formula | C5H3N4NaO |
| Molecular Weight | 158.10 g/mol |
| Exact Mass | 158.02 |
| IUPAC Name | sodium 1H-pyrazolo[5,4-d]pyrimidin-4-olate |
| SMILES | [Na+].[O-]c1ncnc2[nH]ncc12 |
| InChI | InChI=1S/C5H4N4O.Na/c10-5-3-1-8-9-4(3)6-2-7-5;/h1-2H,(H2,6,7,8,9,10);/q;+1/p-1 |
| InChIKey | PTJRZVJXXNYNLN-UHFFFAOYSA-M |
| XLogP | -3.57 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.10 |
| LogP ≤ 5 | -3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze sodium 1H-pyrazolo[5,4-d]pyrimidin-4-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 1H-pyrazolo[5,4-d]pyrimidin-4-olate?
The IUPAC name of sodium 1H-pyrazolo[5,4-d]pyrimidin-4-olate (CID 23662349) is sodium 1H-pyrazolo[5,4-d]pyrimidin-4-olate.
What is the SMILES notation for sodium 1H-pyrazolo[5,4-d]pyrimidin-4-olate?
The canonical SMILES for sodium 1H-pyrazolo[5,4-d]pyrimidin-4-olate is [Na+].[O-]c1ncnc2[nH]ncc12.
What is the InChIKey of sodium 1H-pyrazolo[5,4-d]pyrimidin-4-olate?
The InChIKey is PTJRZVJXXNYNLN-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H4N4O.Na/c10-5-3-1-8-9-4(3)6-2-7-5;/h1-2H,(H2,6,7,8,9,10);/q;+1/p-1.
What are the key properties of sodium 1H-pyrazolo[5,4-d]pyrimidin-4-olate?
sodium 1H-pyrazolo[5,4-d]pyrimidin-4-olate has a molecular weight of 158.10 g/mol, XLogP of -3.57, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 1H-pyrazolo[5,4-d]pyrimidin-4-olate is sourced from PubChem (CID 23662349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).