About sodium bis(2-butoxyethyl) phosphate
sodium bis(2-butoxyethyl) phosphate (PubChem CID 23662444) has the molecular formula C12H26NaO6P
and a molecular weight of 320.30 g/mol. Its IUPAC name is sodium bis(2-butoxyethyl) phosphate.
Molecular Properties
| Compound Name | sodium bis(2-butoxyethyl) phosphate |
| PubChem CID | 23662444 |
| Molecular Formula | C12H26NaO6P |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | sodium bis(2-butoxyethyl) phosphate |
| SMILES | CCCCOCCOP(=O)([O-])OCCOCCCC.[Na+] |
| InChI | InChI=1S/C12H27O6P.Na/c1-3-5-7-15-9-11-17-19(13,14)18-12-10-16-8-6-4-2;/h3-12H2,1-2H3,(H,13,14);/q;+1/p-1 |
| InChIKey | LIEWOUJIFLCDKO-UHFFFAOYSA-M |
| XLogP | -0.87 |
| TPSA | 77.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium bis(2-butoxyethyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium bis(2-butoxyethyl) phosphate?
The IUPAC name of sodium bis(2-butoxyethyl) phosphate (CID 23662444) is sodium bis(2-butoxyethyl) phosphate.
What is the SMILES notation for sodium bis(2-butoxyethyl) phosphate?
The canonical SMILES for sodium bis(2-butoxyethyl) phosphate is CCCCOCCOP(=O)([O-])OCCOCCCC.[Na+].
What is the InChIKey of sodium bis(2-butoxyethyl) phosphate?
The InChIKey is LIEWOUJIFLCDKO-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H27O6P.Na/c1-3-5-7-15-9-11-17-19(13,14)18-12-10-16-8-6-4-2;/h3-12H2,1-2H3,(H,13,14);/q;+1/p-1.
What are the key properties of sodium bis(2-butoxyethyl) phosphate?
sodium bis(2-butoxyethyl) phosphate has a molecular weight of 320.30 g/mol, XLogP of -0.87, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium bis(2-butoxyethyl) phosphate is sourced from PubChem (CID 23662444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).