About potassium 3,5,5-trimethylhexanoate
potassium 3,5,5-trimethylhexanoate (PubChem CID 23662589) has the molecular formula C9H17KO2
and a molecular weight of 196.33 g/mol. Its IUPAC name is potassium 3,5,5-trimethylhexanoate.
Molecular Properties
| Compound Name | potassium 3,5,5-trimethylhexanoate |
| PubChem CID | 23662589 |
| Molecular Formula | C9H17KO2 |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | potassium 3,5,5-trimethylhexanoate |
| SMILES | CC(CC(=O)[O-])CC(C)(C)C.[K+] |
| InChI | InChI=1S/C9H18O2.K/c1-7(5-8(10)11)6-9(2,3)4;/h7H,5-6H2,1-4H3,(H,10,11);/q;+1/p-1 |
| InChIKey | PMTWGKHDSHSGIL-UHFFFAOYSA-M |
| XLogP | -1.80 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze potassium 3,5,5-trimethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 3,5,5-trimethylhexanoate?
The IUPAC name of potassium 3,5,5-trimethylhexanoate (CID 23662589) is potassium 3,5,5-trimethylhexanoate.
What is the SMILES notation for potassium 3,5,5-trimethylhexanoate?
The canonical SMILES for potassium 3,5,5-trimethylhexanoate is CC(CC(=O)[O-])CC(C)(C)C.[K+].
What is the InChIKey of potassium 3,5,5-trimethylhexanoate?
The InChIKey is PMTWGKHDSHSGIL-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H18O2.K/c1-7(5-8(10)11)6-9(2,3)4;/h7H,5-6H2,1-4H3,(H,10,11);/q;+1/p-1.
What are the key properties of potassium 3,5,5-trimethylhexanoate?
potassium 3,5,5-trimethylhexanoate has a molecular weight of 196.33 g/mol, XLogP of -1.80, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 3,5,5-trimethylhexanoate is sourced from PubChem (CID 23662589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).