About sodium N-[(1R,2S)-2-methylcyclohexyl]sulfamate
sodium N-[(1R,2S)-2-methylcyclohexyl]sulfamate (PubChem CID 23663561) has the molecular formula C7H14NNaO3S
and a molecular weight of 215.25 g/mol. Its IUPAC name is sodium N-[(1R,2S)-2-methylcyclohexyl]sulfamate.
Molecular Properties
| Compound Name | sodium N-[(1R,2S)-2-methylcyclohexyl]sulfamate |
| PubChem CID | 23663561 |
| Molecular Formula | C7H14NNaO3S |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | sodium N-[(1R,2S)-2-methylcyclohexyl]sulfamate |
| SMILES | C[C@H]1CCCC[C@H]1NS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C7H15NO3S.Na/c1-6-4-2-3-5-7(6)8-12(9,10)11;/h6-8H,2-5H2,1H3,(H,9,10,11);/q;+1/p-1/t6-,7+;/m0./s1 |
| InChIKey | KICDRYNBOAJDNO-UOERWJHTSA-M |
| XLogP | -2.38 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium N-[(1R,2S)-2-methylcyclohexyl]sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium N-[(1R,2S)-2-methylcyclohexyl]sulfamate?
The IUPAC name of sodium N-[(1R,2S)-2-methylcyclohexyl]sulfamate (CID 23663561) is sodium N-[(1R,2S)-2-methylcyclohexyl]sulfamate.
What is the SMILES notation for sodium N-[(1R,2S)-2-methylcyclohexyl]sulfamate?
The canonical SMILES for sodium N-[(1R,2S)-2-methylcyclohexyl]sulfamate is C[C@H]1CCCC[C@H]1NS(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium N-[(1R,2S)-2-methylcyclohexyl]sulfamate?
The InChIKey is KICDRYNBOAJDNO-UOERWJHTSA-M. The full InChI is InChI=1S/C7H15NO3S.Na/c1-6-4-2-3-5-7(6)8-12(9,10)11;/h6-8H,2-5H2,1H3,(H,9,10,11);/q;+1/p-1/t6-,7+;/m0./s1.
What are the key properties of sodium N-[(1R,2S)-2-methylcyclohexyl]sulfamate?
sodium N-[(1R,2S)-2-methylcyclohexyl]sulfamate has a molecular weight of 215.25 g/mol, XLogP of -2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium N-[(1R,2S)-2-methylcyclohexyl]sulfamate is sourced from PubChem (CID 23663561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).