About sodium;2-propylpentanoate;2-propylpentanoic acid
sodium;2-propylpentanoate;2-propylpentanoic acid (PubChem CID 23663956) has the molecular formula C16H31NaO4
and a molecular weight of 310.41 g/mol. Its IUPAC name is sodium;2-propylpentanoate;2-propylpentanoic acid.
Molecular Properties
| Compound Name | sodium;2-propylpentanoate;2-propylpentanoic acid |
| PubChem CID | 23663956 |
| Molecular Formula | C16H31NaO4 |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | sodium;2-propylpentanoate;2-propylpentanoic acid |
| SMILES | CCCC(CCC)C(=O)O.CCCC(CCC)C(=O)[O-].[Na+] |
| InChI | InChI=1S/2C8H16O2.Na/c2*1-3-5-7(6-4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+1/p-1 |
| InChIKey | MSRILKIQRXUYCT-UHFFFAOYSA-M |
| XLogP | 0.24 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium;2-propylpentanoate;2-propylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-propylpentanoate;2-propylpentanoic acid?
The IUPAC name of sodium;2-propylpentanoate;2-propylpentanoic acid (CID 23663956) is sodium;2-propylpentanoate;2-propylpentanoic acid.
What is the SMILES notation for sodium;2-propylpentanoate;2-propylpentanoic acid?
The canonical SMILES for sodium;2-propylpentanoate;2-propylpentanoic acid is CCCC(CCC)C(=O)O.CCCC(CCC)C(=O)[O-].[Na+].
What is the InChIKey of sodium;2-propylpentanoate;2-propylpentanoic acid?
The InChIKey is MSRILKIQRXUYCT-UHFFFAOYSA-M. The full InChI is InChI=1S/2C8H16O2.Na/c2*1-3-5-7(6-4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+1/p-1.
What are the key properties of sodium;2-propylpentanoate;2-propylpentanoic acid?
sodium;2-propylpentanoate;2-propylpentanoic acid has a molecular weight of 310.41 g/mol, XLogP of 0.24, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-propylpentanoate;2-propylpentanoic acid is sourced from PubChem (CID 23663956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).