About sodium 2-(3,4-dimethylphenyl)-2-oxoacetate
sodium 2-(3,4-dimethylphenyl)-2-oxoacetate (PubChem CID 23664290) has the molecular formula C10H9NaO3
and a molecular weight of 200.17 g/mol. Its IUPAC name is sodium 2-(3,4-dimethylphenyl)-2-oxoacetate.
Molecular Properties
| Compound Name | sodium 2-(3,4-dimethylphenyl)-2-oxoacetate |
| PubChem CID | 23664290 |
| Molecular Formula | C10H9NaO3 |
| Molecular Weight | 200.17 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | sodium 2-(3,4-dimethylphenyl)-2-oxoacetate |
| SMILES | Cc1ccc(C(=O)C(=O)[O-])cc1C.[Na+] |
| InChI | InChI=1S/C10H10O3.Na/c1-6-3-4-8(5-7(6)2)9(11)10(12)13;/h3-5H,1-2H3,(H,12,13);/q;+1/p-1 |
| InChIKey | NONMFFAJXFTYER-UHFFFAOYSA-M |
| XLogP | -2.76 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.17 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-(3,4-dimethylphenyl)-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-(3,4-dimethylphenyl)-2-oxoacetate?
The IUPAC name of sodium 2-(3,4-dimethylphenyl)-2-oxoacetate (CID 23664290) is sodium 2-(3,4-dimethylphenyl)-2-oxoacetate.
What is the SMILES notation for sodium 2-(3,4-dimethylphenyl)-2-oxoacetate?
The canonical SMILES for sodium 2-(3,4-dimethylphenyl)-2-oxoacetate is Cc1ccc(C(=O)C(=O)[O-])cc1C.[Na+].
What is the InChIKey of sodium 2-(3,4-dimethylphenyl)-2-oxoacetate?
The InChIKey is NONMFFAJXFTYER-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H10O3.Na/c1-6-3-4-8(5-7(6)2)9(11)10(12)13;/h3-5H,1-2H3,(H,12,13);/q;+1/p-1.
What are the key properties of sodium 2-(3,4-dimethylphenyl)-2-oxoacetate?
sodium 2-(3,4-dimethylphenyl)-2-oxoacetate has a molecular weight of 200.17 g/mol, XLogP of -2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-(3,4-dimethylphenyl)-2-oxoacetate is sourced from PubChem (CID 23664290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).