About potassium;4-carboxy-1,2,5-thiadiazole-3-carboxylate;hydrate
potassium;4-carboxy-1,2,5-thiadiazole-3-carboxylate;hydrate (PubChem CID 23664354) has the molecular formula C4H3KN2O5S
and a molecular weight of 230.24 g/mol. Its IUPAC name is potassium;4-carboxy-1,2,5-thiadiazole-3-carboxylate;hydrate.
Molecular Properties
| Compound Name | potassium;4-carboxy-1,2,5-thiadiazole-3-carboxylate;hydrate |
| PubChem CID | 23664354 |
| Molecular Formula | C4H3KN2O5S |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 229.94 |
| IUPAC Name | potassium;4-carboxy-1,2,5-thiadiazole-3-carboxylate;hydrate |
| SMILES | O.O=C([O-])c1nsnc1C(=O)O.[K+] |
| InChI | InChI=1S/C4H2N2O4S.K.H2O/c7-3(8)1-2(4(9)10)6-11-5-1;;/h(H,7,8)(H,9,10);;1H2/q;+1;/p-1 |
| InChIKey | BJIVBBVMSPGUDU-UHFFFAOYSA-M |
| XLogP | -5.22 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | -5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze potassium;4-carboxy-1,2,5-thiadiazole-3-carboxylate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;4-carboxy-1,2,5-thiadiazole-3-carboxylate;hydrate?
The IUPAC name of potassium;4-carboxy-1,2,5-thiadiazole-3-carboxylate;hydrate (CID 23664354) is potassium;4-carboxy-1,2,5-thiadiazole-3-carboxylate;hydrate.
What is the SMILES notation for potassium;4-carboxy-1,2,5-thiadiazole-3-carboxylate;hydrate?
The canonical SMILES for potassium;4-carboxy-1,2,5-thiadiazole-3-carboxylate;hydrate is O.O=C([O-])c1nsnc1C(=O)O.[K+].
What is the InChIKey of potassium;4-carboxy-1,2,5-thiadiazole-3-carboxylate;hydrate?
The InChIKey is BJIVBBVMSPGUDU-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H2N2O4S.K.H2O/c7-3(8)1-2(4(9)10)6-11-5-1;;/h(H,7,8)(H,9,10);;1H2/q;+1;/p-1.
What are the key properties of potassium;4-carboxy-1,2,5-thiadiazole-3-carboxylate;hydrate?
potassium;4-carboxy-1,2,5-thiadiazole-3-carboxylate;hydrate has a molecular weight of 230.24 g/mol, XLogP of -5.22, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;4-carboxy-1,2,5-thiadiazole-3-carboxylate;hydrate is sourced from PubChem (CID 23664354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).