sodium pentane-1-sulfonate

C5H11NaO3S — CID 23664617

IUPACsodium pentane-1-sulfonate
SMILESCCCCCS(=O)(=O)[O-].[Na+]
InChIInChI=1S/C5H12O3S.Na/c1-2-3-4-5-9(6,7)8;/h2-5H2,1H3,(H,6,7,8);/q;+1/p-1
InChIKeyROBLTDOHDSGGDT-UHFFFAOYSA-M
MW174.20 g/mol
LogP-2.27
Rot. Bonds4

About sodium pentane-1-sulfonate

sodium pentane-1-sulfonate (PubChem CID 23664617) has the molecular formula C5H11NaO3S and a molecular weight of 174.20 g/mol. Its IUPAC name is sodium pentane-1-sulfonate.

Molecular Properties

Compound Namesodium pentane-1-sulfonate
PubChem CID23664617
Molecular FormulaC5H11NaO3S
Molecular Weight174.20 g/mol
Exact Mass174.03
IUPAC Namesodium pentane-1-sulfonate
SMILESCCCCCS(=O)(=O)[O-].[Na+]
InChIInChI=1S/C5H12O3S.Na/c1-2-3-4-5-9(6,7)8;/h2-5H2,1H3,(H,6,7,8);/q;+1/p-1
InChIKeyROBLTDOHDSGGDT-UHFFFAOYSA-M
XLogP-2.27
TPSA57.20 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.20
LogP ≤ 5-2.27
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sodium pentane-1-sulfonate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium pentane-1-sulfonate?
The IUPAC name of sodium pentane-1-sulfonate (CID 23664617) is sodium pentane-1-sulfonate.
What is the SMILES notation for sodium pentane-1-sulfonate?
The canonical SMILES for sodium pentane-1-sulfonate is CCCCCS(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium pentane-1-sulfonate?
The InChIKey is ROBLTDOHDSGGDT-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H12O3S.Na/c1-2-3-4-5-9(6,7)8;/h2-5H2,1H3,(H,6,7,8);/q;+1/p-1.
What are the key properties of sodium pentane-1-sulfonate?
sodium pentane-1-sulfonate has a molecular weight of 174.20 g/mol, XLogP of -2.27, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium pentane-1-sulfonate is sourced from PubChem (CID 23664617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).