About sodium 4-aminobenzenesulfonate
sodium 4-aminobenzenesulfonate (PubChem CID 23664644) has the molecular formula C6H6NNaO3S
and a molecular weight of 195.18 g/mol. Its IUPAC name is sodium 4-aminobenzenesulfonate.
Molecular Properties
| Compound Name | sodium 4-aminobenzenesulfonate |
| PubChem CID | 23664644 |
| Molecular Formula | C6H6NNaO3S |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.00 |
| IUPAC Name | sodium 4-aminobenzenesulfonate |
| SMILES | Nc1ccc(S(=O)(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C6H7NO3S.Na/c7-5-1-3-6(4-2-5)11(8,9)10;/h1-4H,7H2,(H,8,9,10);/q;+1/p-1 |
| InChIKey | KSVSZLXDULFGDQ-UHFFFAOYSA-M |
| XLogP | -2.82 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 4-aminobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-aminobenzenesulfonate?
The IUPAC name of sodium 4-aminobenzenesulfonate (CID 23664644) is sodium 4-aminobenzenesulfonate.
What is the SMILES notation for sodium 4-aminobenzenesulfonate?
The canonical SMILES for sodium 4-aminobenzenesulfonate is Nc1ccc(S(=O)(=O)[O-])cc1.[Na+].
What is the InChIKey of sodium 4-aminobenzenesulfonate?
The InChIKey is KSVSZLXDULFGDQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H7NO3S.Na/c7-5-1-3-6(4-2-5)11(8,9)10;/h1-4H,7H2,(H,8,9,10);/q;+1/p-1.
What are the key properties of sodium 4-aminobenzenesulfonate?
sodium 4-aminobenzenesulfonate has a molecular weight of 195.18 g/mol, XLogP of -2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-aminobenzenesulfonate is sourced from PubChem (CID 23664644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).