About potassium 3-benzyl-5-carboxy-2,4-dioxo-1H-pyrimidine-6-carboxylate
potassium 3-benzyl-5-carboxy-2,4-dioxo-1H-pyrimidine-6-carboxylate (PubChem CID 23664804) has the molecular formula C13H9KN2O6
and a molecular weight of 328.32 g/mol. Its IUPAC name is potassium 3-benzyl-5-carboxy-2,4-dioxo-1H-pyrimidine-6-carboxylate.
Molecular Properties
| Compound Name | potassium 3-benzyl-5-carboxy-2,4-dioxo-1H-pyrimidine-6-carboxylate |
| PubChem CID | 23664804 |
| Molecular Formula | C13H9KN2O6 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | potassium 3-benzyl-5-carboxy-2,4-dioxo-1H-pyrimidine-6-carboxylate |
| SMILES | O=C([O-])c1[nH]c(=O)n(Cc2ccccc2)c(=O)c1C(=O)O.[K+] |
| InChI | InChI=1S/C13H10N2O6.K/c16-10-8(11(17)18)9(12(19)20)14-13(21)15(10)6-7-4-2-1-3-5-7;/h1-5H,6H2,(H,14,21)(H,17,18)(H,19,20);/q;+1/p-1 |
| InChIKey | YRFJOTIPGIWBJA-UHFFFAOYSA-M |
| XLogP | -4.35 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | -4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze potassium 3-benzyl-5-carboxy-2,4-dioxo-1H-pyrimidine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 3-benzyl-5-carboxy-2,4-dioxo-1H-pyrimidine-6-carboxylate?
The IUPAC name of potassium 3-benzyl-5-carboxy-2,4-dioxo-1H-pyrimidine-6-carboxylate (CID 23664804) is potassium 3-benzyl-5-carboxy-2,4-dioxo-1H-pyrimidine-6-carboxylate.
What is the SMILES notation for potassium 3-benzyl-5-carboxy-2,4-dioxo-1H-pyrimidine-6-carboxylate?
The canonical SMILES for potassium 3-benzyl-5-carboxy-2,4-dioxo-1H-pyrimidine-6-carboxylate is O=C([O-])c1[nH]c(=O)n(Cc2ccccc2)c(=O)c1C(=O)O.[K+].
What is the InChIKey of potassium 3-benzyl-5-carboxy-2,4-dioxo-1H-pyrimidine-6-carboxylate?
The InChIKey is YRFJOTIPGIWBJA-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H10N2O6.K/c16-10-8(11(17)18)9(12(19)20)14-13(21)15(10)6-7-4-2-1-3-5-7;/h1-5H,6H2,(H,14,21)(H,17,18)(H,19,20);/q;+1/p-1.
What are the key properties of potassium 3-benzyl-5-carboxy-2,4-dioxo-1H-pyrimidine-6-carboxylate?
potassium 3-benzyl-5-carboxy-2,4-dioxo-1H-pyrimidine-6-carboxylate has a molecular weight of 328.32 g/mol, XLogP of -4.35, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 3-benzyl-5-carboxy-2,4-dioxo-1H-pyrimidine-6-carboxylate is sourced from PubChem (CID 23664804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).