About sodium;5-carboxy-2,4-dioxo-3-propan-2-yl-1H-pyrimidine-6-carboxylate;hydrate
sodium;5-carboxy-2,4-dioxo-3-propan-2-yl-1H-pyrimidine-6-carboxylate;hydrate (PubChem CID 23664810) has the molecular formula C9H11N2NaO7
and a molecular weight of 282.18 g/mol. Its IUPAC name is sodium;5-carboxy-2,4-dioxo-3-propan-2-yl-1H-pyrimidine-6-carboxylate;hydrate.
Molecular Properties
| Compound Name | sodium;5-carboxy-2,4-dioxo-3-propan-2-yl-1H-pyrimidine-6-carboxylate;hydrate |
| PubChem CID | 23664810 |
| Molecular Formula | C9H11N2NaO7 |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | sodium;5-carboxy-2,4-dioxo-3-propan-2-yl-1H-pyrimidine-6-carboxylate;hydrate |
| SMILES | CC(C)n1c(=O)[nH]c(C(=O)[O-])c(C(=O)O)c1=O.O.[Na+] |
| InChI | InChI=1S/C9H10N2O6.Na.H2O/c1-3(2)11-6(12)4(7(13)14)5(8(15)16)10-9(11)17;;/h3H,1-2H3,(H,10,17)(H,13,14)(H,15,16);;1H2/q;+1;/p-1 |
| InChIKey | GSPDPRPUWXAJJL-UHFFFAOYSA-M |
| XLogP | -5.64 |
| TPSA | 163.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | -5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze sodium;5-carboxy-2,4-dioxo-3-propan-2-yl-1H-pyrimidine-6-carboxylate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;5-carboxy-2,4-dioxo-3-propan-2-yl-1H-pyrimidine-6-carboxylate;hydrate?
The IUPAC name of sodium;5-carboxy-2,4-dioxo-3-propan-2-yl-1H-pyrimidine-6-carboxylate;hydrate (CID 23664810) is sodium;5-carboxy-2,4-dioxo-3-propan-2-yl-1H-pyrimidine-6-carboxylate;hydrate.
What is the SMILES notation for sodium;5-carboxy-2,4-dioxo-3-propan-2-yl-1H-pyrimidine-6-carboxylate;hydrate?
The canonical SMILES for sodium;5-carboxy-2,4-dioxo-3-propan-2-yl-1H-pyrimidine-6-carboxylate;hydrate is CC(C)n1c(=O)[nH]c(C(=O)[O-])c(C(=O)O)c1=O.O.[Na+].
What is the InChIKey of sodium;5-carboxy-2,4-dioxo-3-propan-2-yl-1H-pyrimidine-6-carboxylate;hydrate?
The InChIKey is GSPDPRPUWXAJJL-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H10N2O6.Na.H2O/c1-3(2)11-6(12)4(7(13)14)5(8(15)16)10-9(11)17;;/h3H,1-2H3,(H,10,17)(H,13,14)(H,15,16);;1H2/q;+1;/p-1.
What are the key properties of sodium;5-carboxy-2,4-dioxo-3-propan-2-yl-1H-pyrimidine-6-carboxylate;hydrate?
sodium;5-carboxy-2,4-dioxo-3-propan-2-yl-1H-pyrimidine-6-carboxylate;hydrate has a molecular weight of 282.18 g/mol, XLogP of -5.64, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;5-carboxy-2,4-dioxo-3-propan-2-yl-1H-pyrimidine-6-carboxylate;hydrate is sourced from PubChem (CID 23664810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).