C12H15N2NaO3 — CID 23664950
sodium 5-(cyclohexen-1-yl)-1,5-dimethylpyrimidin-3-ide-2,4,6-trione (PubChem CID 23664950) has the molecular formula C12H15N2NaO3 and a molecular weight of 258.25 g/mol. Its IUPAC name is sodium 5-(cyclohexen-1-yl)-1,5-dimethylpyrimidin-3-ide-2,4,6-trione.
| Compound Name | sodium 5-(cyclohexen-1-yl)-1,5-dimethylpyrimidin-3-ide-2,4,6-trione |
|---|---|
| PubChem CID | 23664950 |
| Molecular Formula | C12H15N2NaO3 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | sodium 5-(cyclohexen-1-yl)-1,5-dimethylpyrimidin-3-ide-2,4,6-trione |
| SMILES | CN1C(=O)[N-]C(=O)C(C)(C2=CCCCC2)C1=O.[Na+] |
| InChI | InChI=1S/C12H16N2O3.Na/c1-12(8-6-4-3-5-7-8)9(15)13-11(17)14(2)10(12)16;/h6H,3-5,7H2,1-2H3,(H,13,15,17);/q;+1/p-1 |
| InChIKey | SQMCFUSVGSBKFK-UHFFFAOYSA-M |
| XLogP | -1.01 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|