C21H32NNaO10S2 — CID 23664988
sodium N-[(4-methylphenyl)methyl]-N-[2,3,5,6-tetrahydroxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]carbamodithioate (PubChem CID 23664988) has the molecular formula C21H32NNaO10S2 and a molecular weight of 545.61 g/mol. Its IUPAC name is sodium N-[(4-methylphenyl)methyl]-N-[2,3,5,6-tetrahydroxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]carbamodithioate.
| Compound Name | sodium N-[(4-methylphenyl)methyl]-N-[2,3,5,6-tetrahydroxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]carbamodithioate |
|---|---|
| PubChem CID | 23664988 |
| Molecular Formula | C21H32NNaO10S2 |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | sodium N-[(4-methylphenyl)methyl]-N-[2,3,5,6-tetrahydroxy-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexyl]carbamodithioate |
| SMILES | Cc1ccc(CN(CC(O)C(O)C(OC2OC(CO)C(O)C(O)C2O)C(O)CO)C(=S)[S-])cc1.[Na+] |
| InChI | InChI=1S/C21H33NO10S2.Na/c1-10-2-4-11(5-3-10)6-22(21(33)34)7-12(25)15(27)19(13(26)8-23)32-20-18(30)17(29)16(28)14(9-24)31-20;/h2-5,12-20,23-30H,6-9H2,1H3,(H,33,34);/q;+1/p-1 |
| InChIKey | XGMAVMGFXICSCU-UHFFFAOYSA-M |
| XLogP | -6.11 |
| TPSA | 183.54 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | -6.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|