About sodium 4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonate
sodium 4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonate (PubChem CID 23665027) has the molecular formula C15H12ClN2NaO3S
and a molecular weight of 358.78 g/mol. Its IUPAC name is sodium 4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonate.
Molecular Properties
| Compound Name | sodium 4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonate |
| PubChem CID | 23665027 |
| Molecular Formula | C15H12ClN2NaO3S |
| Molecular Weight | 358.78 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | sodium 4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(N2CCC(c3ccc(Cl)cc3)=N2)cc1.[Na+] |
| InChI | InChI=1S/C15H13ClN2O3S.Na/c16-12-3-1-11(2-4-12)15-9-10-18(17-15)13-5-7-14(8-6-13)22(19,20)21;/h1-8H,9-10H2,(H,19,20,21);/q;+1/p-1 |
| InChIKey | NPCBDQZLUSJKOW-UHFFFAOYSA-M |
| XLogP | -0.14 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.78 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonate?
The IUPAC name of sodium 4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonate (CID 23665027) is sodium 4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonate.
What is the SMILES notation for sodium 4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonate?
The canonical SMILES for sodium 4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonate is O=S(=O)([O-])c1ccc(N2CCC(c3ccc(Cl)cc3)=N2)cc1.[Na+].
What is the InChIKey of sodium 4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonate?
The InChIKey is NPCBDQZLUSJKOW-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H13ClN2O3S.Na/c16-12-3-1-11(2-4-12)15-9-10-18(17-15)13-5-7-14(8-6-13)22(19,20)21;/h1-8H,9-10H2,(H,19,20,21);/q;+1/p-1.
What are the key properties of sodium 4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonate?
sodium 4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonate has a molecular weight of 358.78 g/mol, XLogP of -0.14, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-[5-(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]benzenesulfonate is sourced from PubChem (CID 23665027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).