About lithium [4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]azanide
lithium [4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]azanide (PubChem CID 23665038) has the molecular formula C11H12LiN3O3S
and a molecular weight of 273.24 g/mol. Its IUPAC name is lithium [4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]azanide.
Molecular Properties
| Compound Name | lithium [4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]azanide |
| PubChem CID | 23665038 |
| Molecular Formula | C11H12LiN3O3S |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | lithium [4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]azanide |
| SMILES | Cc1noc(NS(=O)(=O)c2ccc([NH-])cc2)c1C.[Li+] |
| InChI | InChI=1S/C11H12N3O3S.Li/c1-7-8(2)13-17-11(7)14-18(15,16)10-5-3-9(12)4-6-10;/h3-6,12,14H,1-2H3;/q-1;+1 |
| InChIKey | AOVGZDWJPDXLOI-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 96.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze lithium [4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium [4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]azanide?
The IUPAC name of lithium [4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]azanide (CID 23665038) is lithium [4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]azanide.
What is the SMILES notation for lithium [4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]azanide?
The canonical SMILES for lithium [4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]azanide is Cc1noc(NS(=O)(=O)c2ccc([NH-])cc2)c1C.[Li+].
What is the InChIKey of lithium [4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]azanide?
The InChIKey is AOVGZDWJPDXLOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N3O3S.Li/c1-7-8(2)13-17-11(7)14-18(15,16)10-5-3-9(12)4-6-10;/h3-6,12,14H,1-2H3;/q-1;+1.
What are the key properties of lithium [4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]azanide?
lithium [4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]azanide has a molecular weight of 273.24 g/mol, XLogP of -0.22, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium [4-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]phenyl]azanide is sourced from PubChem (CID 23665038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).