About sodium 2-cyanoethanesulfinate
sodium 2-cyanoethanesulfinate (PubChem CID 23665192) has the molecular formula C3H4NNaO2S
and a molecular weight of 141.13 g/mol. Its IUPAC name is sodium 2-cyanoethanesulfinate.
Molecular Properties
| Compound Name | sodium 2-cyanoethanesulfinate |
| PubChem CID | 23665192 |
| Molecular Formula | C3H4NNaO2S |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 140.99 |
| IUPAC Name | sodium 2-cyanoethanesulfinate |
| SMILES | N#CCCS(=O)[O-].[Na+] |
| InChI | InChI=1S/C3H5NO2S.Na/c4-2-1-3-7(5)6;/h1,3H2,(H,5,6);/q;+1/p-1 |
| InChIKey | VIJZSRLCERKIGY-UHFFFAOYSA-M |
| XLogP | -3.22 |
| TPSA | 63.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-cyanoethanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-cyanoethanesulfinate?
The IUPAC name of sodium 2-cyanoethanesulfinate (CID 23665192) is sodium 2-cyanoethanesulfinate.
What is the SMILES notation for sodium 2-cyanoethanesulfinate?
The canonical SMILES for sodium 2-cyanoethanesulfinate is N#CCCS(=O)[O-].[Na+].
What is the InChIKey of sodium 2-cyanoethanesulfinate?
The InChIKey is VIJZSRLCERKIGY-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H5NO2S.Na/c4-2-1-3-7(5)6;/h1,3H2,(H,5,6);/q;+1/p-1.
What are the key properties of sodium 2-cyanoethanesulfinate?
sodium 2-cyanoethanesulfinate has a molecular weight of 141.13 g/mol, XLogP of -3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-cyanoethanesulfinate is sourced from PubChem (CID 23665192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).