About sodium;acetate;trihydrate
sodium;acetate;trihydrate (PubChem CID 23665404) has the molecular formula C2H9NaO5
and a molecular weight of 136.08 g/mol. Its IUPAC name is sodium;acetate;trihydrate.
Molecular Properties
| Compound Name | sodium;acetate;trihydrate |
| PubChem CID | 23665404 |
| Molecular Formula | C2H9NaO5 |
| Molecular Weight | 136.08 g/mol |
| Exact Mass | 136.03 |
| IUPAC Name | sodium;acetate;trihydrate |
| SMILES | CC(=O)[O-].O.O.O.[Na+] |
| InChI | InChI=1S/C2H4O2.Na.3H2O/c1-2(3)4;;;;/h1H3,(H,3,4);;3*1H2/q;+1;;;/p-1 |
| InChIKey | AYRVGWHSXIMRAB-UHFFFAOYSA-M |
| XLogP | -6.71 |
| TPSA | 134.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.08 |
| LogP ≤ 5 | -6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;acetate;trihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;acetate;trihydrate?
The IUPAC name of sodium;acetate;trihydrate (CID 23665404) is sodium;acetate;trihydrate.
What is the SMILES notation for sodium;acetate;trihydrate?
The canonical SMILES for sodium;acetate;trihydrate is CC(=O)[O-].O.O.O.[Na+].
What is the InChIKey of sodium;acetate;trihydrate?
The InChIKey is AYRVGWHSXIMRAB-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.Na.3H2O/c1-2(3)4;;;;/h1H3,(H,3,4);;3*1H2/q;+1;;;/p-1.
What are the key properties of sodium;acetate;trihydrate?
sodium;acetate;trihydrate has a molecular weight of 136.08 g/mol, XLogP of -6.71, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;acetate;trihydrate is sourced from PubChem (CID 23665404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).