About sodium (2E,4E)-hexa-2,4-dienoate
sodium (2E,4E)-hexa-2,4-dienoate (PubChem CID 23665582) has the molecular formula C6H7NaO2
and a molecular weight of 134.11 g/mol. Its IUPAC name is sodium (2E,4E)-hexa-2,4-dienoate.
Molecular Properties
| Compound Name | sodium (2E,4E)-hexa-2,4-dienoate |
| PubChem CID | 23665582 |
| Molecular Formula | C6H7NaO2 |
| Molecular Weight | 134.11 g/mol |
| Exact Mass | 134.03 |
| IUPAC Name | sodium (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)[O-].[Na+] |
| InChI | InChI=1S/C6H8O2.Na/c1-2-3-4-5-6(7)8;/h2-5H,1H3,(H,7,8);/q;+1/p-1/b3-2+,5-4+; |
| InChIKey | LROWVYNUWKVTCU-STWYSWDKSA-M |
| XLogP | -3.13 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.11 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze sodium (2E,4E)-hexa-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium (2E,4E)-hexa-2,4-dienoate?
The IUPAC name of sodium (2E,4E)-hexa-2,4-dienoate (CID 23665582) is sodium (2E,4E)-hexa-2,4-dienoate.
What is the SMILES notation for sodium (2E,4E)-hexa-2,4-dienoate?
The canonical SMILES for sodium (2E,4E)-hexa-2,4-dienoate is C/C=C/C=C/C(=O)[O-].[Na+].
What is the InChIKey of sodium (2E,4E)-hexa-2,4-dienoate?
The InChIKey is LROWVYNUWKVTCU-STWYSWDKSA-M. The full InChI is InChI=1S/C6H8O2.Na/c1-2-3-4-5-6(7)8;/h2-5H,1H3,(H,7,8);/q;+1/p-1/b3-2+,5-4+;.
What are the key properties of sodium (2E,4E)-hexa-2,4-dienoate?
sodium (2E,4E)-hexa-2,4-dienoate has a molecular weight of 134.11 g/mol, XLogP of -3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium (2E,4E)-hexa-2,4-dienoate is sourced from PubChem (CID 23665582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).