sodium 2-(2,3-dimethylanilino)benzoate

C15H14NNaO2 — CID 23665724

IUPACsodium 2-(2,3-dimethylanilino)benzoate
SMILESCc1cccc(Nc2ccccc2C(=O)[O-])c1C.[Na+]
InChIInChI=1S/C15H15NO2.Na/c1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15(17)18;/h3-9,16H,1-2H3,(H,17,18);/q;+1/p-1
InChIKeyIMCFRCUCBHZBTN-UHFFFAOYSA-M
MW263.27 g/mol
LogP-0.59
Rot. Bonds3

About sodium 2-(2,3-dimethylanilino)benzoate

sodium 2-(2,3-dimethylanilino)benzoate (PubChem CID 23665724) has the molecular formula C15H14NNaO2 and a molecular weight of 263.27 g/mol. Its IUPAC name is sodium 2-(2,3-dimethylanilino)benzoate.

Molecular Properties

Compound Namesodium 2-(2,3-dimethylanilino)benzoate
PubChem CID23665724
Molecular FormulaC15H14NNaO2
Molecular Weight263.27 g/mol
Exact Mass263.09
IUPAC Namesodium 2-(2,3-dimethylanilino)benzoate
SMILESCc1cccc(Nc2ccccc2C(=O)[O-])c1C.[Na+]
InChIInChI=1S/C15H15NO2.Na/c1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15(17)18;/h3-9,16H,1-2H3,(H,17,18);/q;+1/p-1
InChIKeyIMCFRCUCBHZBTN-UHFFFAOYSA-M
XLogP-0.59
TPSA52.16 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.27
LogP ≤ 5-0.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze sodium 2-(2,3-dimethylanilino)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-(2,3-dimethylanilino)benzoate?
The IUPAC name of sodium 2-(2,3-dimethylanilino)benzoate (CID 23665724) is sodium 2-(2,3-dimethylanilino)benzoate.
What is the SMILES notation for sodium 2-(2,3-dimethylanilino)benzoate?
The canonical SMILES for sodium 2-(2,3-dimethylanilino)benzoate is Cc1cccc(Nc2ccccc2C(=O)[O-])c1C.[Na+].
What is the InChIKey of sodium 2-(2,3-dimethylanilino)benzoate?
The InChIKey is IMCFRCUCBHZBTN-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H15NO2.Na/c1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15(17)18;/h3-9,16H,1-2H3,(H,17,18);/q;+1/p-1.
What are the key properties of sodium 2-(2,3-dimethylanilino)benzoate?
sodium 2-(2,3-dimethylanilino)benzoate has a molecular weight of 263.27 g/mol, XLogP of -0.59, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-(2,3-dimethylanilino)benzoate is sourced from PubChem (CID 23665724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).