C22H17F2N3O3S — CID 2366587
N-(2,4-difluorophenyl)-4-(2,5-dimethoxyphenyl)-3-(furan-2-ylmethylideneamino)-1,3-thiazol-2-imine (PubChem CID 2366587) has the molecular formula C22H17F2N3O3S and a molecular weight of 441.46 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-(2,5-dimethoxyphenyl)-3-(furan-2-ylmethylideneamino)-1,3-thiazol-2-imine.
| Compound Name | N-(2,4-difluorophenyl)-4-(2,5-dimethoxyphenyl)-3-(furan-2-ylmethylideneamino)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 2366587 |
| Molecular Formula | C22H17F2N3O3S |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-(2,5-dimethoxyphenyl)-3-(furan-2-ylmethylideneamino)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(OC)c(-c2cs/c(=N\c3ccc(F)cc3F)n2N=Cc2ccco2)c1 |
| InChI | InChI=1S/C22H17F2N3O3S/c1-28-15-6-8-21(29-2)17(11-15)20-13-31-22(26-19-7-5-14(23)10-18(19)24)27(20)25-12-16-4-3-9-30-16/h3-13H,1-2H3/b25-12?,26-22- |
| InChIKey | RKJOQONABXHHDM-OABHXNJTSA-N |
| XLogP | 5.22 |
| TPSA | 61.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|