About sodium 3-acetamido-2,4,6-triiodobenzoate
sodium 3-acetamido-2,4,6-triiodobenzoate (PubChem CID 23665874) has the molecular formula C9H5I3NNaO3
and a molecular weight of 578.85 g/mol. Its IUPAC name is sodium 3-acetamido-2,4,6-triiodobenzoate.
Molecular Properties
| Compound Name | sodium 3-acetamido-2,4,6-triiodobenzoate |
| PubChem CID | 23665874 |
| Molecular Formula | C9H5I3NNaO3 |
| Molecular Weight | 578.85 g/mol |
| Exact Mass | 578.73 |
| IUPAC Name | sodium 3-acetamido-2,4,6-triiodobenzoate |
| SMILES | CC(=O)Nc1c(I)cc(I)c(C(=O)[O-])c1I.[Na+] |
| InChI | InChI=1S/C9H6I3NO3.Na/c1-3(14)13-8-5(11)2-4(10)6(7(8)12)9(15)16;/h2H,1H3,(H,13,14)(H,15,16);/q;+1/p-1 |
| InChIKey | UCPVOMHRDXMAIZ-UHFFFAOYSA-M |
| XLogP | -1.17 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 578.85 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze sodium 3-acetamido-2,4,6-triiodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-acetamido-2,4,6-triiodobenzoate?
The IUPAC name of sodium 3-acetamido-2,4,6-triiodobenzoate (CID 23665874) is sodium 3-acetamido-2,4,6-triiodobenzoate.
What is the SMILES notation for sodium 3-acetamido-2,4,6-triiodobenzoate?
The canonical SMILES for sodium 3-acetamido-2,4,6-triiodobenzoate is CC(=O)Nc1c(I)cc(I)c(C(=O)[O-])c1I.[Na+].
What is the InChIKey of sodium 3-acetamido-2,4,6-triiodobenzoate?
The InChIKey is UCPVOMHRDXMAIZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H6I3NO3.Na/c1-3(14)13-8-5(11)2-4(10)6(7(8)12)9(15)16;/h2H,1H3,(H,13,14)(H,15,16);/q;+1/p-1.
What are the key properties of sodium 3-acetamido-2,4,6-triiodobenzoate?
sodium 3-acetamido-2,4,6-triiodobenzoate has a molecular weight of 578.85 g/mol, XLogP of -1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-acetamido-2,4,6-triiodobenzoate is sourced from PubChem (CID 23665874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).