About sodium 2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate
sodium 2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate (PubChem CID 23665888) has the molecular formula C11H9NaO5S
and a molecular weight of 276.24 g/mol. Its IUPAC name is sodium 2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate.
Molecular Properties
| Compound Name | sodium 2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate |
| PubChem CID | 23665888 |
| Molecular Formula | C11H9NaO5S |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | sodium 2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate |
| SMILES | CC1(S(=O)(=O)[O-])CC(=O)c2ccccc2C1=O.[Na+] |
| InChI | InChI=1S/C11H10O5S.Na/c1-11(17(14,15)16)6-9(12)7-4-2-3-5-8(7)10(11)13;/h2-5H,6H2,1H3,(H,14,15,16);/q;+1/p-1 |
| InChIKey | XDPFHGWVCTXHDX-UHFFFAOYSA-M |
| XLogP | -2.24 |
| TPSA | 91.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate?
The IUPAC name of sodium 2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate (CID 23665888) is sodium 2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate.
What is the SMILES notation for sodium 2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate?
The canonical SMILES for sodium 2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate is CC1(S(=O)(=O)[O-])CC(=O)c2ccccc2C1=O.[Na+].
What is the InChIKey of sodium 2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate?
The InChIKey is XDPFHGWVCTXHDX-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H10O5S.Na/c1-11(17(14,15)16)6-9(12)7-4-2-3-5-8(7)10(11)13;/h2-5H,6H2,1H3,(H,14,15,16);/q;+1/p-1.
What are the key properties of sodium 2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate?
sodium 2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate has a molecular weight of 276.24 g/mol, XLogP of -2.24, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-methyl-1,4-dioxo-3H-naphthalene-2-sulfonate is sourced from PubChem (CID 23665888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).